C12H10F3N3O4S — CID 126579668
N-hydroxy-2-[(1-hydroxypyrazol-3-yl)oxymethyl]-3-(trifluoromethylsulfanyl)benzamide (PubChem CID 126579668) has the molecular formula C12H10F3N3O4S and a molecular weight of 349.29 g/mol. Its IUPAC name is N-hydroxy-2-[(1-hydroxypyrazol-3-yl)oxymethyl]-3-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-hydroxy-2-[(1-hydroxypyrazol-3-yl)oxymethyl]-3-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 126579668 |
| Molecular Formula | C12H10F3N3O4S |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | N-hydroxy-2-[(1-hydroxypyrazol-3-yl)oxymethyl]-3-(trifluoromethylsulfanyl)benzamide |
| SMILES | O=C(NO)c1cccc(SC(F)(F)F)c1COc1ccn(O)n1 |
| InChI | InChI=1S/C12H10F3N3O4S/c13-12(14,15)23-9-3-1-2-7(11(19)17-20)8(9)6-22-10-4-5-18(21)16-10/h1-5,20-21H,6H2,(H,17,19) |
| InChIKey | RRCWLSQAMNYLDW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|