C33H54O4 — CID 126582688
[(3S,5S,8R,10S,13R,17R)-7-acetyloxy-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 126582688) has the molecular formula C33H54O4 and a molecular weight of 514.79 g/mol. Its IUPAC name is [(3S,5S,8R,10S,13R,17R)-7-acetyloxy-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,5S,8R,10S,13R,17R)-7-acetyloxy-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 126582688 |
| Molecular Formula | C33H54O4 |
| Molecular Weight | 514.79 g/mol |
| Exact Mass | 514.40 |
| IUPAC Name | [(3S,5S,8R,10S,13R,17R)-7-acetyloxy-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC[C@H](/C=C/[C@@H](C)[C@H]1CCC2[C@@H]3C(OC(C)=O)C[C@@H]4C[C@@H](OC(C)=O)CC[C@]4(C)C3CC[C@@]21C)C(C)C |
| InChI | InChI=1S/C33H54O4/c1-9-24(20(2)3)11-10-21(4)27-12-13-28-31-29(15-17-33(27,28)8)32(7)16-14-26(36-22(5)34)18-25(32)19-30(31)37-23(6)35/h10-11,20-21,24-31H,9,12-19H2,1-8H3/b11-10+/t21-,24-,25+,26+,27-,28?,29?,30?,31+,32+,33-/m1/s1 |
| InChIKey | IBUMYQRMVGODIL-JHUZTOKBSA-N |
| XLogP | 7.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.79 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|