C30H53OP — CID 135299208
[(3S,5S,8R,10S,13R,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-yl]oxyphosphane (PubChem CID 135299208) has the molecular formula C30H53OP and a molecular weight of 460.73 g/mol. Its IUPAC name is [(3S,5S,8R,10S,13R,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-yl]oxyphosphane.
| Compound Name | [(3S,5S,8R,10S,13R,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-yl]oxyphosphane |
|---|---|
| PubChem CID | 135299208 |
| Molecular Formula | C30H53OP |
| Molecular Weight | 460.73 g/mol |
| Exact Mass | 460.38 |
| IUPAC Name | [(3S,5S,8R,10S,13R,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-yl]oxyphosphane |
| SMILES | CC[C@H](/C=C/[C@@H](C)[C@H]1CCC2[C@@H]3C(OP)C[C@@H]4C[C@@H](C)CC[C@]4(C)C3CC[C@@]21C)C(C)C |
| InChI | InChI=1S/C30H53OP/c1-8-22(19(2)3)10-9-21(5)24-11-12-25-28-26(14-16-30(24,25)7)29(6)15-13-20(4)17-23(29)18-27(28)31-32/h9-10,19-28H,8,11-18,32H2,1-7H3/b10-9+/t20-,21+,22+,23-,24+,25?,26?,27?,28-,29-,30+/m0/s1 |
| InChIKey | YBQZSCWXXZZOIV-TXGHTLOOSA-N |
| XLogP | 8.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.73 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|