C20H24N4O2 — CID 126585783
N-butyl-5-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)-2-methylpyrrolo[3,2-d]pyrimidin-4-amine (PubChem CID 126585783) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is N-butyl-5-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)-2-methylpyrrolo[3,2-d]pyrimidin-4-amine.
| Compound Name | N-butyl-5-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)-2-methylpyrrolo[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 126585783 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | N-butyl-5-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)-2-methylpyrrolo[3,2-d]pyrimidin-4-amine |
| SMILES | CCCCNc1nc(C)nc2ccn(Cc3cccc4c3OCCO4)c12 |
| InChI | InChI=1S/C20H24N4O2/c1-3-4-9-21-20-18-16(22-14(2)23-20)8-10-24(18)13-15-6-5-7-17-19(15)26-12-11-25-17/h5-8,10H,3-4,9,11-13H2,1-2H3,(H,21,22,23) |
| InChIKey | AVTSDTVDKOKYDR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|