C14H22N4 — CID 126585683
N-butyl-2-methyl-5-propan-2-ylpyrrolo[3,2-d]pyrimidin-4-amine (PubChem CID 126585683) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is N-butyl-2-methyl-5-propan-2-ylpyrrolo[3,2-d]pyrimidin-4-amine.
| Compound Name | N-butyl-2-methyl-5-propan-2-ylpyrrolo[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 126585683 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | N-butyl-2-methyl-5-propan-2-ylpyrrolo[3,2-d]pyrimidin-4-amine |
| SMILES | CCCCNc1nc(C)nc2ccn(C(C)C)c12 |
| InChI | InChI=1S/C14H22N4/c1-5-6-8-15-14-13-12(16-11(4)17-14)7-9-18(13)10(2)3/h7,9-10H,5-6,8H2,1-4H3,(H,15,16,17) |
| InChIKey | MWBAZYCADSJZJW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|