C13H18N2O6 — CID 126589420
[acetyl(propanoyl)amino] 4-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)butanoate (PubChem CID 126589420) has the molecular formula C13H18N2O6 and a molecular weight of 298.30 g/mol. Its IUPAC name is [acetyl(propanoyl)amino] 4-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)butanoate.
| Compound Name | [acetyl(propanoyl)amino] 4-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)butanoate |
|---|---|
| PubChem CID | 126589420 |
| Molecular Formula | C13H18N2O6 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | [acetyl(propanoyl)amino] 4-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)butanoate |
| SMILES | CCC(=O)N(OC(=O)CCCN1C(=O)C=CC1O)C(C)=O |
| InChI | InChI=1S/C13H18N2O6/c1-3-10(17)15(9(2)16)21-13(20)5-4-8-14-11(18)6-7-12(14)19/h6-7,11,18H,3-5,8H2,1-2H3 |
| InChIKey | XRNKULDDRCULFN-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|