C11H14N2O6 — CID 146204540
(2-hydroxy-5-oxopyrrolidin-1-yl) 3-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)propanoate (PubChem CID 146204540) has the molecular formula C11H14N2O6 and a molecular weight of 270.24 g/mol. Its IUPAC name is (2-hydroxy-5-oxopyrrolidin-1-yl) 3-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)propanoate.
| Compound Name | (2-hydroxy-5-oxopyrrolidin-1-yl) 3-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)propanoate |
|---|---|
| PubChem CID | 146204540 |
| Molecular Formula | C11H14N2O6 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (2-hydroxy-5-oxopyrrolidin-1-yl) 3-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)propanoate |
| SMILES | O=C(CCN1C(=O)C=CC1O)ON1C(=O)CCC1O |
| InChI | InChI=1S/C11H14N2O6/c14-7-1-2-8(15)12(7)6-5-11(18)19-13-9(16)3-4-10(13)17/h1-2,7,9,14,16H,3-6H2 |
| InChIKey | OJUGHMPZXJYUTF-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |