C9H8N2O6 — CID 134239729
(2-hydroxy-5-oxopyrrolidin-1-yl) 2,5-dioxopyrrole-1-carboxylate (PubChem CID 134239729) has the molecular formula C9H8N2O6 and a molecular weight of 240.17 g/mol. Its IUPAC name is (2-hydroxy-5-oxopyrrolidin-1-yl) 2,5-dioxopyrrole-1-carboxylate.
| Compound Name | (2-hydroxy-5-oxopyrrolidin-1-yl) 2,5-dioxopyrrole-1-carboxylate |
|---|---|
| PubChem CID | 134239729 |
| Molecular Formula | C9H8N2O6 |
| Molecular Weight | 240.17 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | (2-hydroxy-5-oxopyrrolidin-1-yl) 2,5-dioxopyrrole-1-carboxylate |
| SMILES | O=C1C=CC(=O)N1C(=O)ON1C(=O)CCC1O |
| InChI | InChI=1S/C9H8N2O6/c12-5-1-2-6(13)10(5)9(16)17-11-7(14)3-4-8(11)15/h1-2,7,14H,3-4H2 |
| InChIKey | WXVZHKLAUXTENL-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.17 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|