C12H13N2O7+ — CID 87930817
(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-(2,5-dioxopyrrol-1-yl)butanoate (PubChem CID 87930817) has the molecular formula C12H13N2O7+ and a molecular weight of 297.24 g/mol. Its IUPAC name is (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-(2,5-dioxopyrrol-1-yl)butanoate.
| Compound Name | (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-(2,5-dioxopyrrol-1-yl)butanoate |
|---|---|
| PubChem CID | 87930817 |
| Molecular Formula | C12H13N2O7+ |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-(2,5-dioxopyrrol-1-yl)butanoate |
| SMILES | O=C(CCCN1C(=O)C=CC1=O)O[N+]1(O)C(=O)CCC1=O |
| InChI | InChI=1S/C12H13N2O7/c15-8-3-4-9(16)13(8)7-1-2-12(19)21-14(20)10(17)5-6-11(14)18/h3-4,20H,1-2,5-7H2/q+1 |
| InChIKey | KKUFFQLGPXUHLE-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|