C10H8N2O6 — CID 3299229
(2,5-dioxopyrrolidin-1-yl) 2-(2,5-dioxopyrrol-1-yl)acetate (PubChem CID 3299229) has the molecular formula C10H8N2O6 and a molecular weight of 252.18 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-(2,5-dioxopyrrol-1-yl)acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-(2,5-dioxopyrrol-1-yl)acetate |
|---|---|
| PubChem CID | 3299229 |
| Molecular Formula | C10H8N2O6 |
| Molecular Weight | 252.18 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-(2,5-dioxopyrrol-1-yl)acetate |
| SMILES | O=C(CN1C(=O)C=CC1=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C10H8N2O6/c13-6-1-2-7(14)11(6)5-10(17)18-12-8(15)3-4-9(12)16/h1-2H,3-5H2 |
| InChIKey | TYKASZBHFXBROF-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.18 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|