C12H14N2O7 — CID 69254513
4-(2,5-dioxopyrrol-1-yl)butanoic acid;1-hydroxypyrrolidine-2,5-dione (PubChem CID 69254513) has the molecular formula C12H14N2O7 and a molecular weight of 298.25 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)butanoic acid;1-hydroxypyrrolidine-2,5-dione.
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)butanoic acid;1-hydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 69254513 |
| Molecular Formula | C12H14N2O7 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)butanoic acid;1-hydroxypyrrolidine-2,5-dione |
| SMILES | O=C(O)CCCN1C(=O)C=CC1=O.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C8H9NO4.C4H5NO3/c10-6-3-4-7(11)9(6)5-1-2-8(12)13;6-3-1-2-4(7)5(3)8/h3-4H,1-2,5H2,(H,12,13);8H,1-2H2 |
| InChIKey | VLWQPMPFPUXBLV-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|