C10H17N — CID 126592941
(5S)-5,6-dimethyl-2-methylidenehept-6-en-1-imine (PubChem CID 126592941) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (5S)-5,6-dimethyl-2-methylidenehept-6-en-1-imine.
| Compound Name | (5S)-5,6-dimethyl-2-methylidenehept-6-en-1-imine |
|---|---|
| PubChem CID | 126592941 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (5S)-5,6-dimethyl-2-methylidenehept-6-en-1-imine |
| SMILES | [H]/N=C/C(=C)CC[C@H](C)C(=C)C |
| InChI | InChI=1S/C10H17N/c1-8(2)10(4)6-5-9(3)7-11/h7,10-11H,1,3,5-6H2,2,4H3/b11-7+/t10-/m0/s1 |
| InChIKey | JMMBLDNNXAGHHF-VUBLIPMDSA-N |
| XLogP | 3.18 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|