C15H27N3 — CID 126593370
3-methyl-2-(2-methylbutylideneamino)-N'-[(E)-pent-1-enyl]but-2-enimidamide (PubChem CID 126593370) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is 3-methyl-2-(2-methylbutylideneamino)-N'-[(E)-pent-1-enyl]but-2-enimidamide.
| Compound Name | 3-methyl-2-(2-methylbutylideneamino)-N'-[(E)-pent-1-enyl]but-2-enimidamide |
|---|---|
| PubChem CID | 126593370 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 3-methyl-2-(2-methylbutylideneamino)-N'-[(E)-pent-1-enyl]but-2-enimidamide |
| SMILES | CCC/C=C/N=C(\N)C(/N=C/C(C)CC)=C(C)C |
| InChI | InChI=1S/C15H27N3/c1-6-8-9-10-17-15(16)14(12(3)4)18-11-13(5)7-2/h9-11,13H,6-8H2,1-5H3,(H2,16,17)/b10-9+,18-11+ |
| InChIKey | IIDRAQFJJIRALA-XLRUTSMRSA-N |
| XLogP | 4.07 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|