C23H20ClN3O2S — CID 126594038
4-(2-chlorophenyl)-N,5,7-trimethyl-6-pyridin-4-ylquinoline-2-sulfonamide (PubChem CID 126594038) has the molecular formula C23H20ClN3O2S and a molecular weight of 437.95 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N,5,7-trimethyl-6-pyridin-4-ylquinoline-2-sulfonamide.
| Compound Name | 4-(2-chlorophenyl)-N,5,7-trimethyl-6-pyridin-4-ylquinoline-2-sulfonamide |
|---|---|
| PubChem CID | 126594038 |
| Molecular Formula | C23H20ClN3O2S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 4-(2-chlorophenyl)-N,5,7-trimethyl-6-pyridin-4-ylquinoline-2-sulfonamide |
| SMILES | CNS(=O)(=O)c1cc(-c2ccccc2Cl)c2c(C)c(-c3ccncc3)c(C)cc2n1 |
| InChI | InChI=1S/C23H20ClN3O2S/c1-14-12-20-23(15(2)22(14)16-8-10-26-11-9-16)18(17-6-4-5-7-19(17)24)13-21(27-20)30(28,29)25-3/h4-13,25H,1-3H3 |
| InChIKey | LGDWHGHUYPZNMC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |