About S-(aminomethyl) 3-oxo-3-[(2-oxooxolan-3-yl)amino]propanethioate
S-(aminomethyl) 3-oxo-3-[(2-oxooxolan-3-yl)amino]propanethioate (PubChem CID 126596353) has the molecular formula C8H12N2O4S
and a molecular weight of 232.26 g/mol. Its IUPAC name is S-(aminomethyl) 3-oxo-3-[(2-oxooxolan-3-yl)amino]propanethioate.
Molecular Properties
| Compound Name | S-(aminomethyl) 3-oxo-3-[(2-oxooxolan-3-yl)amino]propanethioate |
| PubChem CID | 126596353 |
| Molecular Formula | C8H12N2O4S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | S-(aminomethyl) 3-oxo-3-[(2-oxooxolan-3-yl)amino]propanethioate |
| SMILES | NCSC(=O)CC(=O)NC1CCOC1=O |
| InChI | InChI=1S/C8H12N2O4S/c9-4-15-7(12)3-6(11)10-5-1-2-14-8(5)13/h5H,1-4,9H2,(H,10,11) |
| InChIKey | BZSNFUPFKBGVFV-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(aminomethyl) 3-oxo-3-[(2-oxooxolan-3-yl)amino]propanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(aminomethyl) 3-oxo-3-[(2-oxooxolan-3-yl)amino]propanethioate?
The IUPAC name of S-(aminomethyl) 3-oxo-3-[(2-oxooxolan-3-yl)amino]propanethioate (CID 126596353) is S-(aminomethyl) 3-oxo-3-[(2-oxooxolan-3-yl)amino]propanethioate.
What is the SMILES notation for S-(aminomethyl) 3-oxo-3-[(2-oxooxolan-3-yl)amino]propanethioate?
The canonical SMILES for S-(aminomethyl) 3-oxo-3-[(2-oxooxolan-3-yl)amino]propanethioate is NCSC(=O)CC(=O)NC1CCOC1=O.
What is the InChIKey of S-(aminomethyl) 3-oxo-3-[(2-oxooxolan-3-yl)amino]propanethioate?
The InChIKey is BZSNFUPFKBGVFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O4S/c9-4-15-7(12)3-6(11)10-5-1-2-14-8(5)13/h5H,1-4,9H2,(H,10,11).
What are the key properties of S-(aminomethyl) 3-oxo-3-[(2-oxooxolan-3-yl)amino]propanethioate?
S-(aminomethyl) 3-oxo-3-[(2-oxooxolan-3-yl)amino]propanethioate has a molecular weight of 232.26 g/mol, XLogP of -1.02, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-(aminomethyl) 3-oxo-3-[(2-oxooxolan-3-yl)amino]propanethioate is sourced from PubChem (CID 126596353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).