C23H18N4O2 — CID 126601539
2-[5-(4-cyanophenyl)indazol-1-yl]-N-hydroxy-3-phenylpropanamide (PubChem CID 126601539) has the molecular formula C23H18N4O2 and a molecular weight of 382.42 g/mol. Its IUPAC name is 2-[5-(4-cyanophenyl)indazol-1-yl]-N-hydroxy-3-phenylpropanamide.
| Compound Name | 2-[5-(4-cyanophenyl)indazol-1-yl]-N-hydroxy-3-phenylpropanamide |
|---|---|
| PubChem CID | 126601539 |
| Molecular Formula | C23H18N4O2 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 2-[5-(4-cyanophenyl)indazol-1-yl]-N-hydroxy-3-phenylpropanamide |
| SMILES | N#Cc1ccc(-c2ccc3c(cnn3C(Cc3ccccc3)C(=O)NO)c2)cc1 |
| InChI | InChI=1S/C23H18N4O2/c24-14-17-6-8-18(9-7-17)19-10-11-21-20(13-19)15-25-27(21)22(23(28)26-29)12-16-4-2-1-3-5-16/h1-11,13,15,22,29H,12H2,(H,26,28) |
| InChIKey | JVGSGXDWTZDZRL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|