C17H15ClN2O2 — CID 140901178
methyl 2-(6-chloroindazol-1-yl)-3-phenylpropanoate (PubChem CID 140901178) has the molecular formula C17H15ClN2O2 and a molecular weight of 314.77 g/mol. Its IUPAC name is methyl 2-(6-chloroindazol-1-yl)-3-phenylpropanoate.
| Compound Name | methyl 2-(6-chloroindazol-1-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 140901178 |
| Molecular Formula | C17H15ClN2O2 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | methyl 2-(6-chloroindazol-1-yl)-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)n1ncc2ccc(Cl)cc21 |
| InChI | InChI=1S/C17H15ClN2O2/c1-22-17(21)16(9-12-5-3-2-4-6-12)20-15-10-14(18)8-7-13(15)11-19-20/h2-8,10-11,16H,9H2,1H3 |
| InChIKey | FWLNNVVQNLOOAG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |