C19H17N3O2 — CID 126602162
3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-(4-methoxyanilino)benzonitrile (PubChem CID 126602162) has the molecular formula C19H17N3O2 and a molecular weight of 319.36 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-(4-methoxyanilino)benzonitrile.
| Compound Name | 3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-(4-methoxyanilino)benzonitrile |
|---|---|
| PubChem CID | 126602162 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-(4-methoxyanilino)benzonitrile |
| SMILES | COc1ccc(Nc2cc(C#N)cc(-c3c(C)noc3C)c2)cc1 |
| InChI | InChI=1S/C19H17N3O2/c1-12-19(13(2)24-22-12)15-8-14(11-20)9-17(10-15)21-16-4-6-18(23-3)7-5-16/h4-10,21H,1-3H3 |
| InChIKey | KDQDHAFGWFEOOT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |