C25H24N4O2 — CID 123788680
3-buta-1,3-dienyl-5-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N-(4-methoxyphenyl)imidazol-4-amine (PubChem CID 123788680) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 3-buta-1,3-dienyl-5-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N-(4-methoxyphenyl)imidazol-4-amine.
| Compound Name | 3-buta-1,3-dienyl-5-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N-(4-methoxyphenyl)imidazol-4-amine |
|---|---|
| PubChem CID | 123788680 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 3-buta-1,3-dienyl-5-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N-(4-methoxyphenyl)imidazol-4-amine |
| SMILES | C=CC=Cn1cnc(-c2ccc(-c3c(C)noc3C)cc2)c1Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H24N4O2/c1-5-6-15-29-16-26-24(25(29)27-21-11-13-22(30-4)14-12-21)20-9-7-19(8-10-20)23-17(2)28-31-18(23)3/h5-16,27H,1H2,2-4H3 |
| InChIKey | SMYGOTWVLVDZGX-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 65.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|