C26H23N3O2 — CID 145261859
2-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-9-[(3Z)-2-methylidenehexa-3,5-dienyl]carbazole-4-carbonitrile (PubChem CID 145261859) has the molecular formula C26H23N3O2 and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-9-[(3Z)-2-methylidenehexa-3,5-dienyl]carbazole-4-carbonitrile.
| Compound Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-9-[(3Z)-2-methylidenehexa-3,5-dienyl]carbazole-4-carbonitrile |
|---|---|
| PubChem CID | 145261859 |
| Molecular Formula | C26H23N3O2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-9-[(3Z)-2-methylidenehexa-3,5-dienyl]carbazole-4-carbonitrile |
| SMILES | C=C/C=C\C(=C)Cn1c2ccc(OC)cc2c2c(C#N)cc(-c3c(C)noc3C)cc21 |
| InChI | InChI=1S/C26H23N3O2/c1-6-7-8-16(2)15-29-23-10-9-21(30-5)13-22(23)26-20(14-27)11-19(12-24(26)29)25-17(3)28-31-18(25)4/h6-13H,1-2,15H2,3-5H3/b8-7- |
| InChIKey | OGTQEATWOXCMPS-FPLPWBNLSA-N |
| XLogP | 6.25 |
| TPSA | 63.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|