C29H35N3O2 — CID 145233051
2-(3,5-dimethyl-1,2-oxazol-4-yl)-9-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]carbazole-4-carboxamide;ethane;methane (PubChem CID 145233051) has the molecular formula C29H35N3O2 and a molecular weight of 457.62 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2-oxazol-4-yl)-9-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]carbazole-4-carboxamide;ethane;methane.
| Compound Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-9-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]carbazole-4-carboxamide;ethane;methane |
|---|---|
| PubChem CID | 145233051 |
| Molecular Formula | C29H35N3O2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-9-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]carbazole-4-carboxamide;ethane;methane |
| SMILES | C.C=C/C(=C\C=C/C)Cn1c2ccccc2c2c(C(N)=O)cc(-c3c(C)noc3C)cc21.CC |
| InChI | InChI=1S/C26H25N3O2.C2H6.CH4/c1-5-7-10-18(6-2)15-29-22-12-9-8-11-20(22)25-21(26(27)30)13-19(14-23(25)29)24-16(3)28-31-17(24)4;1-2;/h5-14H,2,15H2,1,3-4H3,(H2,27,30);1-2H3;1H4/b7-5-,18-10+;; |
| InChIKey | GCXMXVACFPYQCK-JEIZBBGISA-N |
| XLogP | 7.52 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|