C30H30N4O2 — CID 90376549
9-benzyl-6-(cyclopentylamino)-2-(3,5-dimethyl-1,2-oxazol-4-yl)carbazole-4-carboxamide (PubChem CID 90376549) has the molecular formula C30H30N4O2 and a molecular weight of 478.60 g/mol. Its IUPAC name is 9-benzyl-6-(cyclopentylamino)-2-(3,5-dimethyl-1,2-oxazol-4-yl)carbazole-4-carboxamide.
| Compound Name | 9-benzyl-6-(cyclopentylamino)-2-(3,5-dimethyl-1,2-oxazol-4-yl)carbazole-4-carboxamide |
|---|---|
| PubChem CID | 90376549 |
| Molecular Formula | C30H30N4O2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 9-benzyl-6-(cyclopentylamino)-2-(3,5-dimethyl-1,2-oxazol-4-yl)carbazole-4-carboxamide |
| SMILES | Cc1noc(C)c1-c1cc(C(N)=O)c2c3cc(NC4CCCC4)ccc3n(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C30H30N4O2/c1-18-28(19(2)36-33-18)21-14-25(30(31)35)29-24-16-23(32-22-10-6-7-11-22)12-13-26(24)34(27(29)15-21)17-20-8-4-3-5-9-20/h3-5,8-9,12-16,22,32H,6-7,10-11,17H2,1-2H3,(H2,31,35) |
| InChIKey | IVYXFCGSQAJMSS-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 86.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|