C32H33ClN4O4 — CID 134378908
9-[(4-chlorophenyl)methyl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-ethyl-6-[formyl(3-methoxypropyl)amino]carbazole-4-carboxamide (PubChem CID 134378908) has the molecular formula C32H33ClN4O4 and a molecular weight of 573.09 g/mol. Its IUPAC name is 9-[(4-chlorophenyl)methyl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-ethyl-6-[formyl(3-methoxypropyl)amino]carbazole-4-carboxamide.
| Compound Name | 9-[(4-chlorophenyl)methyl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-ethyl-6-[formyl(3-methoxypropyl)amino]carbazole-4-carboxamide |
|---|---|
| PubChem CID | 134378908 |
| Molecular Formula | C32H33ClN4O4 |
| Molecular Weight | 573.09 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | 9-[(4-chlorophenyl)methyl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-ethyl-6-[formyl(3-methoxypropyl)amino]carbazole-4-carboxamide |
| SMILES | CCNC(=O)c1cc(-c2c(C)noc2C)cc2c1c1cc(N(C=O)CCCOC)ccc1n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H33ClN4O4/c1-5-34-32(39)27-15-23(30-20(2)35-41-21(30)3)16-29-31(27)26-17-25(36(19-38)13-6-14-40-4)11-12-28(26)37(29)18-22-7-9-24(33)10-8-22/h7-12,15-17,19H,5-6,13-14,18H2,1-4H3,(H,34,39) |
| InChIKey | RABSQLHJXQKDDE-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.09 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|