About N-(4-iodobutyl)carbamoyl iodide
N-(4-iodobutyl)carbamoyl iodide (PubChem CID 126602978) has the molecular formula C5H9I2NO
and a molecular weight of 352.94 g/mol. Its IUPAC name is N-(4-iodobutyl)carbamoyl iodide.
Molecular Properties
| Compound Name | N-(4-iodobutyl)carbamoyl iodide |
| PubChem CID | 126602978 |
| Molecular Formula | C5H9I2NO |
| Molecular Weight | 352.94 g/mol |
| Exact Mass | 352.88 |
| IUPAC Name | N-(4-iodobutyl)carbamoyl iodide |
| SMILES | O=C(I)NCCCCI |
| InChI | InChI=1S/C5H9I2NO/c6-3-1-2-4-8-5(7)9/h1-4H2,(H,8,9) |
| InChIKey | SPDJEVSJLBEHFJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.94 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(4-iodobutyl)carbamoyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-iodobutyl)carbamoyl iodide?
The IUPAC name of N-(4-iodobutyl)carbamoyl iodide (CID 126602978) is N-(4-iodobutyl)carbamoyl iodide.
What is the SMILES notation for N-(4-iodobutyl)carbamoyl iodide?
The canonical SMILES for N-(4-iodobutyl)carbamoyl iodide is O=C(I)NCCCCI.
What is the InChIKey of N-(4-iodobutyl)carbamoyl iodide?
The InChIKey is SPDJEVSJLBEHFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9I2NO/c6-3-1-2-4-8-5(7)9/h1-4H2,(H,8,9).
What are the key properties of N-(4-iodobutyl)carbamoyl iodide?
N-(4-iodobutyl)carbamoyl iodide has a molecular weight of 352.94 g/mol, XLogP of 2.35, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-iodobutyl)carbamoyl iodide is sourced from PubChem (CID 126602978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).