C14H12N2O3 — CID 126604142
(E)-2-cyano-3-[2-methoxy-4-(prop-2-ynylamino)phenyl]prop-2-enoic acid (PubChem CID 126604142) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is (E)-2-cyano-3-[2-methoxy-4-(prop-2-ynylamino)phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[2-methoxy-4-(prop-2-ynylamino)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 126604142 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | (E)-2-cyano-3-[2-methoxy-4-(prop-2-ynylamino)phenyl]prop-2-enoic acid |
| SMILES | C#CCNc1ccc(/C=C(\C#N)C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C14H12N2O3/c1-3-6-16-12-5-4-10(13(8-12)19-2)7-11(9-15)14(17)18/h1,4-5,7-8,16H,6H2,2H3,(H,17,18)/b11-7+ |
| InChIKey | WGCBMBBUNTUBIB-YRNVUSSQSA-N |
| XLogP | 1.73 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|