C21H24ClN7OS — CID 126605696
2-[4-chloro-2-(methylamino)benzenecarboximidoyl]-N-[3-(methylsulfanylamino)cyclopentyl]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 126605696) has the molecular formula C21H24ClN7OS and a molecular weight of 457.99 g/mol. Its IUPAC name is 2-[4-chloro-2-(methylamino)benzenecarboximidoyl]-N-[3-(methylsulfanylamino)cyclopentyl]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-[4-chloro-2-(methylamino)benzenecarboximidoyl]-N-[3-(methylsulfanylamino)cyclopentyl]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 126605696 |
| Molecular Formula | C21H24ClN7OS |
| Molecular Weight | 457.99 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 2-[4-chloro-2-(methylamino)benzenecarboximidoyl]-N-[3-(methylsulfanylamino)cyclopentyl]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | [H]/N=C(\c1cnc2[nH]cc(C(=O)NC3CCC(NSC)C3)c2n1)c1ccc(Cl)cc1NC |
| InChI | InChI=1S/C21H24ClN7OS/c1-24-16-7-11(22)3-6-14(16)18(23)17-10-26-20-19(28-17)15(9-25-20)21(30)27-12-4-5-13(8-12)29-31-2/h3,6-7,9-10,12-13,23-24,29H,4-5,8H2,1-2H3,(H,25,26)(H,27,30)/b23-18- |
| InChIKey | KADQYGPMMVDWAD-NKFKGCMQSA-N |
| XLogP | 3.59 |
| TPSA | 118.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.99 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|