C19H19ClN6OS — CID 126605828
2-[4-chloro-2-(methylamino)benzenecarboximidoyl]-N-(thiolan-3-yl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 126605828) has the molecular formula C19H19ClN6OS and a molecular weight of 414.92 g/mol. Its IUPAC name is 2-[4-chloro-2-(methylamino)benzenecarboximidoyl]-N-(thiolan-3-yl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-[4-chloro-2-(methylamino)benzenecarboximidoyl]-N-(thiolan-3-yl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 126605828 |
| Molecular Formula | C19H19ClN6OS |
| Molecular Weight | 414.92 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 2-[4-chloro-2-(methylamino)benzenecarboximidoyl]-N-(thiolan-3-yl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | [H]/N=C(\c1cnc2[nH]cc(C(=O)NC3CCSC3)c2n1)c1ccc(Cl)cc1NC |
| InChI | InChI=1S/C19H19ClN6OS/c1-22-14-6-10(20)2-3-12(14)16(21)15-8-24-18-17(26-15)13(7-23-18)19(27)25-11-4-5-28-9-11/h2-3,6-8,11,21-22H,4-5,9H2,1H3,(H,23,24)(H,25,27)/b21-16- |
| InChIKey | KKCGCVKOVGGSOP-PGMHBOJBSA-N |
| XLogP | 3.30 |
| TPSA | 106.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.92 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|