C24H23ClN4O3S — CID 126606410
2-[(4R)-6-(4-chlorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1]benzazepin-4-yl]-1-(1,1-dioxo-1,3-thiazinan-3-yl)ethanone (PubChem CID 126606410) has the molecular formula C24H23ClN4O3S and a molecular weight of 482.99 g/mol. Its IUPAC name is 2-[(4R)-6-(4-chlorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1]benzazepin-4-yl]-1-(1,1-dioxo-1,3-thiazinan-3-yl)ethanone.
| Compound Name | 2-[(4R)-6-(4-chlorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1]benzazepin-4-yl]-1-(1,1-dioxo-1,3-thiazinan-3-yl)ethanone |
|---|---|
| PubChem CID | 126606410 |
| Molecular Formula | C24H23ClN4O3S |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 2-[(4R)-6-(4-chlorophenyl)-1-methyl-4H-[1,2,4]triazolo[4,3-a][1]benzazepin-4-yl]-1-(1,1-dioxo-1,3-thiazinan-3-yl)ethanone |
| SMILES | Cc1nnc2n1-c1ccccc1C(c1ccc(Cl)cc1)=C[C@H]2CC(=O)N1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C24H23ClN4O3S/c1-16-26-27-24-18(14-23(30)28-11-4-12-33(31,32)15-28)13-21(17-7-9-19(25)10-8-17)20-5-2-3-6-22(20)29(16)24/h2-3,5-10,13,18H,4,11-12,14-15H2,1H3/t18-/m0/s1 |
| InChIKey | KGYYPELJCLVFSW-SFHVURJKSA-N |
| XLogP | 3.75 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |