C28H35ClN6OS — CID 118281644
2-[7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,11,12-triazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-[3-(4-methylpiperazin-1-yl)propyl]acetamide (PubChem CID 118281644) has the molecular formula C28H35ClN6OS and a molecular weight of 539.15 g/mol. Its IUPAC name is 2-[7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,11,12-triazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-[3-(4-methylpiperazin-1-yl)propyl]acetamide.
| Compound Name | 2-[7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,11,12-triazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-[3-(4-methylpiperazin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 118281644 |
| Molecular Formula | C28H35ClN6OS |
| Molecular Weight | 539.15 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | 2-[7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,11,12-triazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-[3-(4-methylpiperazin-1-yl)propyl]acetamide |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=CC(CC(=O)NCCCN1CCN(C)CC1)c1nnc(C)n1-2 |
| InChI | InChI=1S/C28H35ClN6OS/c1-18-19(2)37-28-26(18)24(21-6-8-23(29)9-7-21)16-22(27-32-31-20(3)35(27)28)17-25(36)30-10-5-11-34-14-12-33(4)13-15-34/h6-9,16,22H,5,10-15,17H2,1-4H3,(H,30,36) |
| InChIKey | AMIQHPUURAMDOP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.15 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|