C26H34Cl2N6OS — CID 169003593
N-(7-aminoheptyl)-2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetamide;hydrochloride (PubChem CID 169003593) has the molecular formula C26H34Cl2N6OS and a molecular weight of 549.57 g/mol. Its IUPAC name is N-(7-aminoheptyl)-2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetamide;hydrochloride.
| Compound Name | N-(7-aminoheptyl)-2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 169003593 |
| Molecular Formula | C26H34Cl2N6OS |
| Molecular Weight | 549.57 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | N-(7-aminoheptyl)-2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetamide;hydrochloride |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)NCCCCCCCN)c1nnc(C)n1-2.Cl |
| InChI | InChI=1S/C26H33ClN6OS.ClH/c1-16-17(2)35-26-23(16)24(19-9-11-20(27)12-10-19)30-21(25-32-31-18(3)33(25)26)15-22(34)29-14-8-6-4-5-7-13-28;/h9-12,21H,4-8,13-15,28H2,1-3H3,(H,29,34);1H/t21-;/m0./s1 |
| InChIKey | YLNNUEPIODSFGR-BOXHHOBZSA-N |
| XLogP | 5.64 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.57 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|