C25H32Cl2N6O3S — CID 142535935
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetamide;hydrochloride (PubChem CID 142535935) has the molecular formula C25H32Cl2N6O3S and a molecular weight of 567.54 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetamide;hydrochloride.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 142535935 |
| Molecular Formula | C25H32Cl2N6O3S |
| Molecular Weight | 567.54 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetamide;hydrochloride |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)NCCOCCOCCN)c1nnc(C)n1-2.Cl |
| InChI | InChI=1S/C25H31ClN6O3S.ClH/c1-15-16(2)36-25-22(15)23(18-4-6-19(26)7-5-18)29-20(24-31-30-17(3)32(24)25)14-21(33)28-9-11-35-13-12-34-10-8-27;/h4-7,20H,8-14,27H2,1-3H3,(H,28,33);1H/t20-;/m0./s1 |
| InChIKey | HWNAKRGZUWGROA-BDQAORGHSA-N |
| XLogP | 3.72 |
| TPSA | 116.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.54 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|