C25H28ClN5O5S — CID 177203648
2-[2-[2-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]ethoxy]ethoxy]acetic acid (PubChem CID 177203648) has the molecular formula C25H28ClN5O5S and a molecular weight of 546.05 g/mol. Its IUPAC name is 2-[2-[2-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 177203648 |
| Molecular Formula | C25H28ClN5O5S |
| Molecular Weight | 546.05 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | 2-[2-[2-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]ethoxy]ethoxy]acetic acid |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)NCCOCCOCC(=O)O)c1nnc(C)n1-2 |
| InChI | InChI=1S/C25H28ClN5O5S/c1-14-15(2)37-25-22(14)23(17-4-6-18(26)7-5-17)28-19(24-30-29-16(3)31(24)25)12-20(32)27-8-9-35-10-11-36-13-21(33)34/h4-7,19H,8-13H2,1-3H3,(H,27,32)(H,33,34)/t19-/m0/s1 |
| InChIKey | YYAZCLJCKHJMMP-IBGZPJMESA-N |
| XLogP | 3.42 |
| TPSA | 127.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.05 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|