C30H39ClN6O4S — CID 171764165
N-[2-[2-[2-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]ethoxy]ethoxy]ethyl]-2,2-dimethylpropanamide (PubChem CID 171764165) has the molecular formula C30H39ClN6O4S and a molecular weight of 615.20 g/mol. Its IUPAC name is N-[2-[2-[2-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]ethoxy]ethoxy]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[2-[2-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]ethoxy]ethoxy]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 171764165 |
| Molecular Formula | C30H39ClN6O4S |
| Molecular Weight | 615.20 g/mol |
| Exact Mass | 614.24 |
| IUPAC Name | N-[2-[2-[2-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]ethoxy]ethoxy]ethyl]-2,2-dimethylpropanamide |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)NCCOCCOCCNC(=O)C(C)(C)C)c1nnc(C)n1-2 |
| InChI | InChI=1S/C30H39ClN6O4S/c1-18-19(2)42-28-25(18)26(21-7-9-22(31)10-8-21)34-23(27-36-35-20(3)37(27)28)17-24(38)32-11-13-40-15-16-41-14-12-33-29(39)30(4,5)6/h7-10,23H,11-17H2,1-6H3,(H,32,38)(H,33,39)/t23-/m0/s1 |
| InChIKey | VADYAYZAVPMOPM-QHCPKHFHSA-N |
| XLogP | 4.50 |
| TPSA | 119.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.20 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|