C25H29ClN6O3S — CID 171795181
6-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]-N-hydroxyhexanamide (PubChem CID 171795181) has the molecular formula C25H29ClN6O3S and a molecular weight of 529.07 g/mol. Its IUPAC name is 6-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]-N-hydroxyhexanamide.
| Compound Name | 6-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 171795181 |
| Molecular Formula | C25H29ClN6O3S |
| Molecular Weight | 529.07 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | 6-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]-N-hydroxyhexanamide |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)NCCCCCC(=O)NO)c1nnc(C)n1-2 |
| InChI | InChI=1S/C25H29ClN6O3S/c1-14-15(2)36-25-22(14)23(17-8-10-18(26)11-9-17)28-19(24-30-29-16(3)32(24)25)13-21(34)27-12-6-4-5-7-20(33)31-35/h8-11,19,35H,4-7,12-13H2,1-3H3,(H,27,34)(H,31,33)/t19-/m0/s1 |
| InChIKey | VNDOXQRJACDUHB-IBGZPJMESA-N |
| XLogP | 4.37 |
| TPSA | 121.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.07 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|