C19H20FN5 — CID 126607534
(Z)-4-[3-(4-fluorophenyl)-1-methylpyrazol-4-yl]-4-imino-N'-[(1E,3E)-penta-1,3-dienyl]but-2-enimidamide (PubChem CID 126607534) has the molecular formula C19H20FN5 and a molecular weight of 337.40 g/mol. Its IUPAC name is (Z)-4-[3-(4-fluorophenyl)-1-methylpyrazol-4-yl]-4-imino-N'-[(1E,3E)-penta-1,3-dienyl]but-2-enimidamide.
| Compound Name | (Z)-4-[3-(4-fluorophenyl)-1-methylpyrazol-4-yl]-4-imino-N'-[(1E,3E)-penta-1,3-dienyl]but-2-enimidamide |
|---|---|
| PubChem CID | 126607534 |
| Molecular Formula | C19H20FN5 |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (Z)-4-[3-(4-fluorophenyl)-1-methylpyrazol-4-yl]-4-imino-N'-[(1E,3E)-penta-1,3-dienyl]but-2-enimidamide |
| SMILES | [H]/N=C(/C=C\C(N)=N\C=C\C=C\C)c1cn(C)nc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H20FN5/c1-3-4-5-12-23-18(22)11-10-17(21)16-13-25(2)24-19(16)14-6-8-15(20)9-7-14/h3-13,21H,1-2H3,(H2,22,23)/b4-3+,11-10-,12-5+,21-17- |
| InChIKey | OUESUGHVVSKJPQ-HONGOBHYSA-N |
| XLogP | 3.60 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|