C36H44O8 — CID 126608880
(2R,4aR,6S)-7-[(2S,4R,5S)-4,5-dimethyl-6-(phenylmethoxymethyl)oxan-2-yl]oxy-6-methoxy-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 126608880) has the molecular formula C36H44O8 and a molecular weight of 604.74 g/mol. Its IUPAC name is (2R,4aR,6S)-7-[(2S,4R,5S)-4,5-dimethyl-6-(phenylmethoxymethyl)oxan-2-yl]oxy-6-methoxy-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (2R,4aR,6S)-7-[(2S,4R,5S)-4,5-dimethyl-6-(phenylmethoxymethyl)oxan-2-yl]oxy-6-methoxy-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 126608880 |
| Molecular Formula | C36H44O8 |
| Molecular Weight | 604.74 g/mol |
| Exact Mass | 604.30 |
| IUPAC Name | (2R,4aR,6S)-7-[(2S,4R,5S)-4,5-dimethyl-6-(phenylmethoxymethyl)oxan-2-yl]oxy-6-methoxy-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)OC2C(OCc2ccccc2)C1O[C@H]1C[C@@H](C)[C@H](C)C(COCc2ccccc2)O1 |
| InChI | InChI=1S/C36H44O8/c1-24-19-31(41-29(25(24)2)22-38-20-26-13-7-4-8-14-26)43-34-33(39-21-27-15-9-5-10-16-27)32-30(42-36(34)37-3)23-40-35(44-32)28-17-11-6-12-18-28/h4-18,24-25,29-36H,19-23H2,1-3H3/t24-,25+,29?,30-,31+,32?,33?,34?,35-,36+/m1/s1 |
| InChIKey | KFUQVKOGYSBRCR-DPAVHRJXSA-N |
| XLogP | 6.05 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.74 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |