About 1,3-dipentylurea
1,3-dipentylurea (PubChem CID 12660908) has the molecular formula C11H24N2O
and a molecular weight of 200.33 g/mol. Its IUPAC name is 1,3-dipentylurea.
Molecular Properties
| Compound Name | 1,3-dipentylurea |
| PubChem CID | 12660908 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 1,3-dipentylurea |
| SMILES | CCCCCNC(=O)NCCCCC |
| InChI | InChI=1S/C11H24N2O/c1-3-5-7-9-12-11(14)13-10-8-6-4-2/h3-10H2,1-2H3,(H2,12,13,14) |
| InChIKey | RLTCCPGGBDHZLJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dipentylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dipentylurea?
The IUPAC name of 1,3-dipentylurea (CID 12660908) is 1,3-dipentylurea.
What is the SMILES notation for 1,3-dipentylurea?
The canonical SMILES for 1,3-dipentylurea is CCCCCNC(=O)NCCCCC.
What is the InChIKey of 1,3-dipentylurea?
The InChIKey is RLTCCPGGBDHZLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O/c1-3-5-7-9-12-11(14)13-10-8-6-4-2/h3-10H2,1-2H3,(H2,12,13,14).
What are the key properties of 1,3-dipentylurea?
1,3-dipentylurea has a molecular weight of 200.33 g/mol, XLogP of 2.67, 8 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dipentylurea is sourced from PubChem (CID 12660908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).