C19H18N2O2 — CID 126609690
[(E)-1-(1-methylindol-3-yl)ethylideneamino] 2-phenylacetate (PubChem CID 126609690) has the molecular formula C19H18N2O2 and a molecular weight of 306.36 g/mol. Its IUPAC name is [(E)-1-(1-methylindol-3-yl)ethylideneamino] 2-phenylacetate.
| Compound Name | [(E)-1-(1-methylindol-3-yl)ethylideneamino] 2-phenylacetate |
|---|---|
| PubChem CID | 126609690 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | [(E)-1-(1-methylindol-3-yl)ethylideneamino] 2-phenylacetate |
| SMILES | C/C(=N\OC(=O)Cc1ccccc1)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C19H18N2O2/c1-14(17-13-21(2)18-11-7-6-10-16(17)18)20-23-19(22)12-15-8-4-3-5-9-15/h3-11,13H,12H2,1-2H3/b20-14+ |
| InChIKey | XQGIINGSZWYAJP-XSFVSMFZSA-N |
| XLogP | 3.69 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|