C25H23F2NO3 — CID 126609867
2-[2-[[2-fluoro-5-(3-fluorophenyl)benzoyl]amino]phenyl]ethyl 2-methylpropanoate (PubChem CID 126609867) has the molecular formula C25H23F2NO3 and a molecular weight of 423.46 g/mol. Its IUPAC name is 2-[2-[[2-fluoro-5-(3-fluorophenyl)benzoyl]amino]phenyl]ethyl 2-methylpropanoate.
| Compound Name | 2-[2-[[2-fluoro-5-(3-fluorophenyl)benzoyl]amino]phenyl]ethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 126609867 |
| Molecular Formula | C25H23F2NO3 |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 2-[2-[[2-fluoro-5-(3-fluorophenyl)benzoyl]amino]phenyl]ethyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCCc1ccccc1NC(=O)c1cc(-c2cccc(F)c2)ccc1F |
| InChI | InChI=1S/C25H23F2NO3/c1-16(2)25(30)31-13-12-17-6-3-4-9-23(17)28-24(29)21-15-19(10-11-22(21)27)18-7-5-8-20(26)14-18/h3-11,14-16H,12-13H2,1-2H3,(H,28,29) |
| InChIKey | CEXQLCIHZUZADP-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |