C24H21F2NO3 — CID 126609860
[2-[[2-fluoro-5-(3-fluorophenyl)benzoyl]amino]phenyl]methyl 2-methylpropanoate (PubChem CID 126609860) has the molecular formula C24H21F2NO3 and a molecular weight of 409.43 g/mol. Its IUPAC name is [2-[[2-fluoro-5-(3-fluorophenyl)benzoyl]amino]phenyl]methyl 2-methylpropanoate.
| Compound Name | [2-[[2-fluoro-5-(3-fluorophenyl)benzoyl]amino]phenyl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 126609860 |
| Molecular Formula | C24H21F2NO3 |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | [2-[[2-fluoro-5-(3-fluorophenyl)benzoyl]amino]phenyl]methyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCc1ccccc1NC(=O)c1cc(-c2cccc(F)c2)ccc1F |
| InChI | InChI=1S/C24H21F2NO3/c1-15(2)24(29)30-14-18-6-3-4-9-22(18)27-23(28)20-13-17(10-11-21(20)26)16-7-5-8-19(25)12-16/h3-13,15H,14H2,1-2H3,(H,27,28) |
| InChIKey | KVNVNIKPSHRNNT-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |