C37H46O2 — CID 126610228
[4-[4-[(E)-dec-3-enyl]phenyl]phenyl] 4-[(E)-oct-5-enyl]benzoate (PubChem CID 126610228) has the molecular formula C37H46O2 and a molecular weight of 522.77 g/mol. Its IUPAC name is [4-[4-[(E)-dec-3-enyl]phenyl]phenyl] 4-[(E)-oct-5-enyl]benzoate.
| Compound Name | [4-[4-[(E)-dec-3-enyl]phenyl]phenyl] 4-[(E)-oct-5-enyl]benzoate |
|---|---|
| PubChem CID | 126610228 |
| Molecular Formula | C37H46O2 |
| Molecular Weight | 522.77 g/mol |
| Exact Mass | 522.35 |
| IUPAC Name | [4-[4-[(E)-dec-3-enyl]phenyl]phenyl] 4-[(E)-oct-5-enyl]benzoate |
| SMILES | CC/C=C/CCCCc1ccc(C(=O)Oc2ccc(-c3ccc(CC/C=C/CCCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H46O2/c1-3-5-7-9-11-12-14-16-17-31-19-23-33(24-20-31)34-27-29-36(30-28-34)39-37(38)35-25-21-32(22-26-35)18-15-13-10-8-6-4-2/h6,8,12,14,19-30H,3-5,7,9-11,13,15-18H2,1-2H3/b8-6+,14-12+ |
| InChIKey | HJIUEQKHWYBQBB-HBUFCQDRSA-N |
| XLogP | 10.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.77 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|