C26H21N5O3S — CID 126610574
1-[[5-[3-(1-methyl-2-phenylindol-5-yl)-5-nitrophenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]propan-2-one (PubChem CID 126610574) has the molecular formula C26H21N5O3S and a molecular weight of 483.55 g/mol. Its IUPAC name is 1-[[5-[3-(1-methyl-2-phenylindol-5-yl)-5-nitrophenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]propan-2-one.
| Compound Name | 1-[[5-[3-(1-methyl-2-phenylindol-5-yl)-5-nitrophenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]propan-2-one |
|---|---|
| PubChem CID | 126610574 |
| Molecular Formula | C26H21N5O3S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 1-[[5-[3-(1-methyl-2-phenylindol-5-yl)-5-nitrophenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]propan-2-one |
| SMILES | CC(=O)CSc1n[nH]c(-c2cc(-c3ccc4c(c3)cc(-c3ccccc3)n4C)cc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C26H21N5O3S/c1-16(32)15-35-26-27-25(28-29-26)21-11-19(12-22(13-21)31(33)34)18-8-9-23-20(10-18)14-24(30(23)2)17-6-4-3-5-7-17/h3-14H,15H2,1-2H3,(H,27,28,29) |
| InChIKey | XZXRKFLCQQZVDD-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|