C14H12N4OS — CID 126610605
1-[(5-quinolin-6-yl-1H-1,2,4-triazol-3-yl)sulfanyl]propan-2-one (PubChem CID 126610605) has the molecular formula C14H12N4OS and a molecular weight of 284.34 g/mol. Its IUPAC name is 1-[(5-quinolin-6-yl-1H-1,2,4-triazol-3-yl)sulfanyl]propan-2-one.
| Compound Name | 1-[(5-quinolin-6-yl-1H-1,2,4-triazol-3-yl)sulfanyl]propan-2-one |
|---|---|
| PubChem CID | 126610605 |
| Molecular Formula | C14H12N4OS |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 1-[(5-quinolin-6-yl-1H-1,2,4-triazol-3-yl)sulfanyl]propan-2-one |
| SMILES | CC(=O)CSc1n[nH]c(-c2ccc3ncccc3c2)n1 |
| InChI | InChI=1S/C14H12N4OS/c1-9(19)8-20-14-16-13(17-18-14)11-4-5-12-10(7-11)3-2-6-15-12/h2-7H,8H2,1H3,(H,16,17,18) |
| InChIKey | QSJKMMISUADXDY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |