C20H19N5OS — CID 144951817
3-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)-N-methoxy-5-quinolin-6-ylaniline (PubChem CID 144951817) has the molecular formula C20H19N5OS and a molecular weight of 377.47 g/mol. Its IUPAC name is 3-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)-N-methoxy-5-quinolin-6-ylaniline.
| Compound Name | 3-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)-N-methoxy-5-quinolin-6-ylaniline |
|---|---|
| PubChem CID | 144951817 |
| Molecular Formula | C20H19N5OS |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 3-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)-N-methoxy-5-quinolin-6-ylaniline |
| SMILES | CCSc1n[nH]c(-c2cc(NOC)cc(-c3ccc4ncccc4c3)c2)n1 |
| InChI | InChI=1S/C20H19N5OS/c1-3-27-20-22-19(23-24-20)16-10-15(11-17(12-16)25-26-2)13-6-7-18-14(9-13)5-4-8-21-18/h4-12,25H,3H2,1-2H3,(H,22,23,24) |
| InChIKey | MMJFTNVFGRFLPI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|