C21H16ClN4O4S- — CID 163658944
2-[[5-[3-(4-chloronaphthalen-2-yl)-5-[methoxy(oxido)amino]phenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 163658944) has the molecular formula C21H16ClN4O4S- and a molecular weight of 455.90 g/mol. Its IUPAC name is 2-[[5-[3-(4-chloronaphthalen-2-yl)-5-[methoxy(oxido)amino]phenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-[3-(4-chloronaphthalen-2-yl)-5-[methoxy(oxido)amino]phenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 163658944 |
| Molecular Formula | C21H16ClN4O4S- |
| Molecular Weight | 455.90 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | 2-[[5-[3-(4-chloronaphthalen-2-yl)-5-[methoxy(oxido)amino]phenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | CON([O-])c1cc(-c2cc(Cl)c3ccccc3c2)cc(-c2nc(SCC(=O)O)n[nH]2)c1 |
| InChI | InChI=1S/C21H16ClN4O4S/c1-30-26(29)16-8-13(14-6-12-4-2-3-5-17(12)18(22)10-14)7-15(9-16)20-23-21(25-24-20)31-11-19(27)28/h2-10H,11H2,1H3,(H,27,28)(H,23,24,25)/q-1 |
| InChIKey | ISRVUELVGRWCQK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.90 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|