C16H14N4O5S — CID 163693585
3-[3-(carboxymethylsulfanyl)-1H-1,2,4-triazol-5-yl]-N-hydroxy-5-(4-hydroxyphenyl)benzeneamine oxide (PubChem CID 163693585) has the molecular formula C16H14N4O5S and a molecular weight of 374.38 g/mol. Its IUPAC name is 3-[3-(carboxymethylsulfanyl)-1H-1,2,4-triazol-5-yl]-N-hydroxy-5-(4-hydroxyphenyl)benzeneamine oxide.
| Compound Name | 3-[3-(carboxymethylsulfanyl)-1H-1,2,4-triazol-5-yl]-N-hydroxy-5-(4-hydroxyphenyl)benzeneamine oxide |
|---|---|
| PubChem CID | 163693585 |
| Molecular Formula | C16H14N4O5S |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 3-[3-(carboxymethylsulfanyl)-1H-1,2,4-triazol-5-yl]-N-hydroxy-5-(4-hydroxyphenyl)benzeneamine oxide |
| SMILES | O=C(O)CSc1n[nH]c(-c2cc(-c3ccc(O)cc3)cc([NH+]([O-])O)c2)n1 |
| InChI | InChI=1S/C16H14N4O5S/c21-13-3-1-9(2-4-13)10-5-11(7-12(6-10)20(24)25)15-17-16(19-18-15)26-8-14(22)23/h1-7,20-21,24H,8H2,(H,22,23)(H,17,18,19) |
| InChIKey | JVAZJVNTQQMIOX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 146.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|