C11H9I2N3OS — CID 137267282
4-[3-[(E)-2,3-diiodoprop-2-enyl]sulfanyl-1H-1,2,4-triazol-5-yl]phenol (PubChem CID 137267282) has the molecular formula C11H9I2N3OS and a molecular weight of 485.09 g/mol. Its IUPAC name is 4-[3-[(E)-2,3-diiodoprop-2-enyl]sulfanyl-1H-1,2,4-triazol-5-yl]phenol.
| Compound Name | 4-[3-[(E)-2,3-diiodoprop-2-enyl]sulfanyl-1H-1,2,4-triazol-5-yl]phenol |
|---|---|
| PubChem CID | 137267282 |
| Molecular Formula | C11H9I2N3OS |
| Molecular Weight | 485.09 g/mol |
| Exact Mass | 484.86 |
| IUPAC Name | 4-[3-[(E)-2,3-diiodoprop-2-enyl]sulfanyl-1H-1,2,4-triazol-5-yl]phenol |
| SMILES | Oc1ccc(-c2nc(SC/C(I)=C\I)n[nH]2)cc1 |
| InChI | InChI=1S/C11H9I2N3OS/c12-5-8(13)6-18-11-14-10(15-16-11)7-1-3-9(17)4-2-7/h1-5,17H,6H2,(H,14,15,16)/b8-5+ |
| InChIKey | JNWGWEBZNOUQRU-VMPITWQZSA-N |
| XLogP | 3.98 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.09 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|