C22H26N5O3S+ — CID 144951656
ethane;hydroxy-[3-[3-(2-oxoethylsulfanyl)-1H-1,2,4-triazol-5-yl]-5-quinolin-6-ylphenyl]azanium;methanol (PubChem CID 144951656) has the molecular formula C22H26N5O3S+ and a molecular weight of 440.55 g/mol. Its IUPAC name is ethane;hydroxy-[3-[3-(2-oxoethylsulfanyl)-1H-1,2,4-triazol-5-yl]-5-quinolin-6-ylphenyl]azanium;methanol.
| Compound Name | ethane;hydroxy-[3-[3-(2-oxoethylsulfanyl)-1H-1,2,4-triazol-5-yl]-5-quinolin-6-ylphenyl]azanium;methanol |
|---|---|
| PubChem CID | 144951656 |
| Molecular Formula | C22H26N5O3S+ |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | ethane;hydroxy-[3-[3-(2-oxoethylsulfanyl)-1H-1,2,4-triazol-5-yl]-5-quinolin-6-ylphenyl]azanium;methanol |
| SMILES | CC.CO.O=CCSc1n[nH]c(-c2cc([NH2+]O)cc(-c3ccc4ncccc4c3)c2)n1 |
| InChI | InChI=1S/C19H15N5O2S.C2H6.CH4O/c25-6-7-27-19-21-18(22-23-19)15-9-14(10-16(11-15)24-26)12-3-4-17-13(8-12)2-1-5-20-17;2*1-2/h1-6,8-11,24,26H,7H2,(H,21,22,23);1-2H3;2H,1H3/p+1 |
| InChIKey | IXHRSNPSZNTMJM-UHFFFAOYSA-O |
| XLogP | 3.20 |
| TPSA | 128.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|