C17H19N3O4S — CID 144951455
methanol;2-[[5-[5-(4-methoxy-3-methylphenyl)furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetaldehyde (PubChem CID 144951455) has the molecular formula C17H19N3O4S and a molecular weight of 361.42 g/mol. Its IUPAC name is methanol;2-[[5-[5-(4-methoxy-3-methylphenyl)furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetaldehyde.
| Compound Name | methanol;2-[[5-[5-(4-methoxy-3-methylphenyl)furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetaldehyde |
|---|---|
| PubChem CID | 144951455 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | methanol;2-[[5-[5-(4-methoxy-3-methylphenyl)furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetaldehyde |
| SMILES | CO.COc1ccc(-c2ccc(-c3nc(SCC=O)n[nH]3)o2)cc1C |
| InChI | InChI=1S/C16H15N3O3S.CH4O/c1-10-9-11(3-4-12(10)21-2)13-5-6-14(22-13)15-17-16(19-18-15)23-8-7-20;1-2/h3-7,9H,8H2,1-2H3,(H,17,18,19);2H,1H3 |
| InChIKey | UIDVLQRMJCKDQV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 101.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|