C25H26N4O5S — CID 145085720
ethane;2-[[5-[5-[4-methoxy-3-[(E)-phenylmethoxyiminomethyl]phenyl]furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 145085720) has the molecular formula C25H26N4O5S and a molecular weight of 494.57 g/mol. Its IUPAC name is ethane;2-[[5-[5-[4-methoxy-3-[(E)-phenylmethoxyiminomethyl]phenyl]furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | ethane;2-[[5-[5-[4-methoxy-3-[(E)-phenylmethoxyiminomethyl]phenyl]furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 145085720 |
| Molecular Formula | C25H26N4O5S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | ethane;2-[[5-[5-[4-methoxy-3-[(E)-phenylmethoxyiminomethyl]phenyl]furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | CC.COc1ccc(-c2ccc(-c3nc(SCC(=O)O)n[nH]3)o2)cc1/C=N/OCc1ccccc1 |
| InChI | InChI=1S/C23H20N4O5S.C2H6/c1-30-18-8-7-16(11-17(18)12-24-31-13-15-5-3-2-4-6-15)19-9-10-20(32-19)22-25-23(27-26-22)33-14-21(28)29;1-2/h2-12H,13-14H2,1H3,(H,28,29)(H,25,26,27);1-2H3/b24-12+; |
| InChIKey | PGUYUZNVKCMDKD-DFVQGABXSA-N |
| XLogP | 5.49 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|